C14H18ClNO3 — CID 114218452
5-chloro-2-(2-ethyl-1,4-oxazepan-4-yl)benzoic acid (PubChem CID 114218452) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is 5-chloro-2-(2-ethyl-1,4-oxazepan-4-yl)benzoic acid.
| Compound Name | 5-chloro-2-(2-ethyl-1,4-oxazepan-4-yl)benzoic acid |
|---|---|
| PubChem CID | 114218452 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 5-chloro-2-(2-ethyl-1,4-oxazepan-4-yl)benzoic acid |
| SMILES | CCC1CN(c2ccc(Cl)cc2C(=O)O)CCCO1 |
| InChI | InChI=1S/C14H18ClNO3/c1-2-11-9-16(6-3-7-19-11)13-5-4-10(15)8-12(13)14(17)18/h4-5,8,11H,2-3,6-7,9H2,1H3,(H,17,18) |
| InChIKey | OBPUTNAQEZBXFD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |