C21H32ClNO2 — CID 13078635
5-chloro-2-(4-nonan-5-ylpiperidin-1-yl)benzoic acid (PubChem CID 13078635) has the molecular formula C21H32ClNO2 and a molecular weight of 365.95 g/mol. Its IUPAC name is 5-chloro-2-(4-nonan-5-ylpiperidin-1-yl)benzoic acid.
| Compound Name | 5-chloro-2-(4-nonan-5-ylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 13078635 |
| Molecular Formula | C21H32ClNO2 |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 5-chloro-2-(4-nonan-5-ylpiperidin-1-yl)benzoic acid |
| SMILES | CCCCC(CCCC)C1CCN(c2ccc(Cl)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C21H32ClNO2/c1-3-5-7-16(8-6-4-2)17-11-13-23(14-12-17)20-10-9-18(22)15-19(20)21(24)25/h9-10,15-17H,3-8,11-14H2,1-2H3,(H,24,25) |
| InChIKey | FDZZKUCGEMKPHL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |