C26H24Cl2N4 — CID 635250
7-chloro-N-[4-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]phenyl]quinolin-4-amine (PubChem CID 635250) has the molecular formula C26H24Cl2N4 and a molecular weight of 463.41 g/mol. Its IUPAC name is 7-chloro-N-[4-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]phenyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[4-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 635250 |
| Molecular Formula | C26H24Cl2N4 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 7-chloro-N-[4-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]phenyl]quinolin-4-amine |
| SMILES | Cc1ccc(N2CCN(c3ccc(Nc4ccnc5cc(Cl)ccc45)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C26H24Cl2N4/c1-18-2-6-22(17-24(18)28)32-14-12-31(13-15-32)21-7-4-20(5-8-21)30-25-10-11-29-26-16-19(27)3-9-23(25)26/h2-11,16-17H,12-15H2,1H3,(H,29,30) |
| InChIKey | DLXFPDSQUUHWIJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|