C21H24ClN3 — CID 24774700
7-chloro-N-[3-(diethylaminomethyl)-4-methylphenyl]quinolin-4-amine (PubChem CID 24774700) has the molecular formula C21H24ClN3 and a molecular weight of 353.90 g/mol. Its IUPAC name is 7-chloro-N-[3-(diethylaminomethyl)-4-methylphenyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-(diethylaminomethyl)-4-methylphenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 24774700 |
| Molecular Formula | C21H24ClN3 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 7-chloro-N-[3-(diethylaminomethyl)-4-methylphenyl]quinolin-4-amine |
| SMILES | CCN(CC)Cc1cc(Nc2ccnc3cc(Cl)ccc23)ccc1C |
| InChI | InChI=1S/C21H24ClN3/c1-4-25(5-2)14-16-12-18(8-6-15(16)3)24-20-10-11-23-21-13-17(22)7-9-19(20)21/h6-13H,4-5,14H2,1-3H3,(H,23,24) |
| InChIKey | DZCGUAYCGSIVCF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |