C27H28ClN5O2 — CID 44613083
1-[2-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl-ethylamino]ethyl]-3-phenylurea (PubChem CID 44613083) has the molecular formula C27H28ClN5O2 and a molecular weight of 490.01 g/mol. Its IUPAC name is 1-[2-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl-ethylamino]ethyl]-3-phenylurea.
| Compound Name | 1-[2-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl-ethylamino]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 44613083 |
| Molecular Formula | C27H28ClN5O2 |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 1-[2-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl-ethylamino]ethyl]-3-phenylurea |
| SMILES | CCN(CCNC(=O)Nc1ccccc1)Cc1cc(Nc2ccnc3cc(Cl)ccc23)ccc1O |
| InChI | InChI=1S/C27H28ClN5O2/c1-2-33(15-14-30-27(35)32-21-6-4-3-5-7-21)18-19-16-22(9-11-26(19)34)31-24-12-13-29-25-17-20(28)8-10-23(24)25/h3-13,16-17,34H,2,14-15,18H2,1H3,(H,29,31)(H2,30,32,35) |
| InChIKey | KXCAIPNSWURICF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|