C25H32Cl3N5O2 — CID 3061378
4-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]-N,N-diethylpiperazine-1-carboxamide;dihydrochloride (PubChem CID 3061378) has the molecular formula C25H32Cl3N5O2 and a molecular weight of 540.92 g/mol. Its IUPAC name is 4-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]-N,N-diethylpiperazine-1-carboxamide;dihydrochloride.
| Compound Name | 4-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]-N,N-diethylpiperazine-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 3061378 |
| Molecular Formula | C25H32Cl3N5O2 |
| Molecular Weight | 540.92 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 4-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]-N,N-diethylpiperazine-1-carboxamide;dihydrochloride |
| SMILES | CCN(CC)C(=O)N1CCN(Cc2cc(Nc3ccnc4cc(Cl)ccc34)ccc2O)CC1.Cl.Cl |
| InChI | InChI=1S/C25H30ClN5O2.2ClH/c1-3-30(4-2)25(33)31-13-11-29(12-14-31)17-18-15-20(6-8-24(18)32)28-22-9-10-27-23-16-19(26)5-7-21(22)23;;/h5-10,15-16,32H,3-4,11-14,17H2,1-2H3,(H,27,28);2*1H |
| InChIKey | KQGPCNKARUJCLQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.92 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|