C30H43ClN4O — CID 162520037
4-[(7-chloroquinolin-4-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol;ethane;propane (PubChem CID 162520037) has the molecular formula C30H43ClN4O and a molecular weight of 511.15 g/mol. Its IUPAC name is 4-[(7-chloroquinolin-4-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol;ethane;propane.
| Compound Name | 4-[(7-chloroquinolin-4-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol;ethane;propane |
|---|---|
| PubChem CID | 162520037 |
| Molecular Formula | C30H43ClN4O |
| Molecular Weight | 511.15 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 4-[(7-chloroquinolin-4-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol;ethane;propane |
| SMILES | CC.CCC.Oc1c(CN2CCCC2)cc(Nc2ccnc3cc(Cl)ccc23)cc1CN1CCCC1 |
| InChI | InChI=1S/C25H29ClN4O.C3H8.C2H6/c26-20-5-6-22-23(7-8-27-24(22)15-20)28-21-13-18(16-29-9-1-2-10-29)25(31)19(14-21)17-30-11-3-4-12-30;1-3-2;1-2/h5-8,13-15,31H,1-4,9-12,16-17H2,(H,27,28);3H2,1-2H3;1-2H3 |
| InChIKey | YONKGBKKJAJCDX-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.15 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|