C23H26Cl2N4 — CID 44572182
7-chloro-N-[4-chloro-3-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]quinolin-4-amine (PubChem CID 44572182) has the molecular formula C23H26Cl2N4 and a molecular weight of 429.40 g/mol. Its IUPAC name is 7-chloro-N-[4-chloro-3-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[4-chloro-3-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 44572182 |
| Molecular Formula | C23H26Cl2N4 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 7-chloro-N-[4-chloro-3-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]quinolin-4-amine |
| SMILES | CC(C)N1CCN(Cc2cc(Nc3ccnc4cc(Cl)ccc34)ccc2Cl)CC1 |
| InChI | InChI=1S/C23H26Cl2N4/c1-16(2)29-11-9-28(10-12-29)15-17-13-19(4-6-21(17)25)27-22-7-8-26-23-14-18(24)3-5-20(22)23/h3-8,13-14,16H,9-12,15H2,1-2H3,(H,26,27) |
| InChIKey | WEVWEYJRYRWKRU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |