C19H21Cl2N3O — CID 44537303
4-[(7-chloroquinolin-4-yl)amino]-2-[(propan-2-ylamino)methyl]phenol;hydrochloride (PubChem CID 44537303) has the molecular formula C19H21Cl2N3O and a molecular weight of 378.30 g/mol. Its IUPAC name is 4-[(7-chloroquinolin-4-yl)amino]-2-[(propan-2-ylamino)methyl]phenol;hydrochloride.
| Compound Name | 4-[(7-chloroquinolin-4-yl)amino]-2-[(propan-2-ylamino)methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 44537303 |
| Molecular Formula | C19H21Cl2N3O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 4-[(7-chloroquinolin-4-yl)amino]-2-[(propan-2-ylamino)methyl]phenol;hydrochloride |
| SMILES | CC(C)NCc1cc(Nc2ccnc3cc(Cl)ccc23)ccc1O.Cl |
| InChI | InChI=1S/C19H20ClN3O.ClH/c1-12(2)22-11-13-9-15(4-6-19(13)24)23-17-7-8-21-18-10-14(20)3-5-16(17)18;/h3-10,12,22,24H,11H2,1-2H3,(H,21,23);1H |
| InChIKey | UHVCTWIVWJECTQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|