C20H24Cl3N3O — CID 51071988
2-[(tert-butylamino)methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol;dihydrochloride (PubChem CID 51071988) has the molecular formula C20H24Cl3N3O and a molecular weight of 428.79 g/mol. Its IUPAC name is 2-[(tert-butylamino)methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol;dihydrochloride.
| Compound Name | 2-[(tert-butylamino)methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol;dihydrochloride |
|---|---|
| PubChem CID | 51071988 |
| Molecular Formula | C20H24Cl3N3O |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2-[(tert-butylamino)methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol;dihydrochloride |
| SMILES | CC(C)(C)NCc1ccc(Nc2ccnc3cc(Cl)ccc23)cc1O.Cl.Cl |
| InChI | InChI=1S/C20H22ClN3O.2ClH/c1-20(2,3)23-12-13-4-6-15(11-19(13)25)24-17-8-9-22-18-10-14(21)5-7-16(17)18;;/h4-11,23,25H,12H2,1-3H3,(H,22,24);2*1H |
| InChIKey | UDVALKJFXQVZSI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|