C23H25ClN4O4 — CID 53230848
2-[1-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]piperidin-4-yl]ethyl nitrate (PubChem CID 53230848) has the molecular formula C23H25ClN4O4 and a molecular weight of 456.93 g/mol. Its IUPAC name is 2-[1-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]piperidin-4-yl]ethyl nitrate.
| Compound Name | 2-[1-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]piperidin-4-yl]ethyl nitrate |
|---|---|
| PubChem CID | 53230848 |
| Molecular Formula | C23H25ClN4O4 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-[1-[[5-[(7-chloroquinolin-4-yl)amino]-2-hydroxyphenyl]methyl]piperidin-4-yl]ethyl nitrate |
| SMILES | O=[N+]([O-])OCCC1CCN(Cc2cc(Nc3ccnc4cc(Cl)ccc34)ccc2O)CC1 |
| InChI | InChI=1S/C23H25ClN4O4/c24-18-1-3-20-21(5-9-25-22(20)14-18)26-19-2-4-23(29)17(13-19)15-27-10-6-16(7-11-27)8-12-32-28(30)31/h1-5,9,13-14,16,29H,6-8,10-12,15H2,(H,25,26) |
| InChIKey | YTAGXFMBZQNUOP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|