C26H25Cl2N3OS — CID 547239
2-(4-chlorophenyl)sulfanyl-4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)phenol (PubChem CID 547239) has the molecular formula C26H25Cl2N3OS and a molecular weight of 498.48 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)phenol.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)phenol |
|---|---|
| PubChem CID | 547239 |
| Molecular Formula | C26H25Cl2N3OS |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)phenol |
| SMILES | CCN(CC)Cc1cc(Nc2ccnc3cc(Cl)ccc23)cc(Sc2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C26H25Cl2N3OS/c1-3-31(4-2)16-17-13-20(15-25(26(17)32)33-21-8-5-18(27)6-9-21)30-23-11-12-29-24-14-19(28)7-10-22(23)24/h5-15,32H,3-4,16H2,1-2H3,(H,29,30) |
| InChIKey | WBYWRCKFKLRPJI-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|