C22H24ClN3O2 — CID 54005492
2-(diethylamino)ethyl 4-[(7-chloroquinolin-4-yl)amino]benzoate (PubChem CID 54005492) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(7-chloroquinolin-4-yl)amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(7-chloroquinolin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 54005492 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(7-chloroquinolin-4-yl)amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(Nc2ccnc3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-3-26(4-2)13-14-28-22(27)16-5-8-18(9-6-16)25-20-11-12-24-21-15-17(23)7-10-19(20)21/h5-12,15H,3-4,13-14H2,1-2H3,(H,24,25) |
| InChIKey | KOOSWOYQDAQQIP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |