C20H19ClFN3O2 — CID 23331684
2-(dimethylamino)ethyl 2-[(7-chloroquinolin-4-yl)amino]-5-fluorobenzoate (PubChem CID 23331684) has the molecular formula C20H19ClFN3O2 and a molecular weight of 387.84 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-[(7-chloroquinolin-4-yl)amino]-5-fluorobenzoate.
| Compound Name | 2-(dimethylamino)ethyl 2-[(7-chloroquinolin-4-yl)amino]-5-fluorobenzoate |
|---|---|
| PubChem CID | 23331684 |
| Molecular Formula | C20H19ClFN3O2 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-[(7-chloroquinolin-4-yl)amino]-5-fluorobenzoate |
| SMILES | CN(C)CCOC(=O)c1cc(F)ccc1Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H19ClFN3O2/c1-25(2)9-10-27-20(26)16-12-14(22)4-6-17(16)24-18-7-8-23-19-11-13(21)3-5-15(18)19/h3-8,11-12H,9-10H2,1-2H3,(H,23,24) |
| InChIKey | BLSPUXXZJIRRRV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |