C28H29Cl3N4O2 — CID 3039708
2-(4-phenylpiperazin-1-yl)ethyl 2-[(7-chloroquinolin-4-yl)amino]benzoate;dihydrochloride (PubChem CID 3039708) has the molecular formula C28H29Cl3N4O2 and a molecular weight of 559.93 g/mol. Its IUPAC name is 2-(4-phenylpiperazin-1-yl)ethyl 2-[(7-chloroquinolin-4-yl)amino]benzoate;dihydrochloride.
| Compound Name | 2-(4-phenylpiperazin-1-yl)ethyl 2-[(7-chloroquinolin-4-yl)amino]benzoate;dihydrochloride |
|---|---|
| PubChem CID | 3039708 |
| Molecular Formula | C28H29Cl3N4O2 |
| Molecular Weight | 559.93 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 2-(4-phenylpiperazin-1-yl)ethyl 2-[(7-chloroquinolin-4-yl)amino]benzoate;dihydrochloride |
| SMILES | Cl.Cl.O=C(OCCN1CCN(c2ccccc2)CC1)c1ccccc1Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C28H27ClN4O2.2ClH/c29-21-10-11-23-26(12-13-30-27(23)20-21)31-25-9-5-4-8-24(25)28(34)35-19-18-32-14-16-33(17-15-32)22-6-2-1-3-7-22;;/h1-13,20H,14-19H2,(H,30,31);2*1H |
| InChIKey | LQSKLJQPTVDPGT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.93 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |