C28H28Cl2N2O2 — CID 10051464
1-(4-chlorophenyl)ethyl 2-[(7-butan-2-ylquinolin-4-yl)amino]benzoate;hydrochloride (PubChem CID 10051464) has the molecular formula C28H28Cl2N2O2 and a molecular weight of 495.45 g/mol. Its IUPAC name is 1-(4-chlorophenyl)ethyl 2-[(7-butan-2-ylquinolin-4-yl)amino]benzoate;hydrochloride.
| Compound Name | 1-(4-chlorophenyl)ethyl 2-[(7-butan-2-ylquinolin-4-yl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 10051464 |
| Molecular Formula | C28H28Cl2N2O2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 1-(4-chlorophenyl)ethyl 2-[(7-butan-2-ylquinolin-4-yl)amino]benzoate;hydrochloride |
| SMILES | CCC(C)c1ccc2c(Nc3ccccc3C(=O)OC(C)c3ccc(Cl)cc3)ccnc2c1.Cl |
| InChI | InChI=1S/C28H27ClN2O2.ClH/c1-4-18(2)21-11-14-23-26(15-16-30-27(23)17-21)31-25-8-6-5-7-24(25)28(32)33-19(3)20-9-12-22(29)13-10-20;/h5-19H,4H2,1-3H3,(H,30,31);1H |
| InChIKey | VVWQCTNYZFKTNP-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |