C21H22Cl2N2O2 — CID 69165819
butyl 2-[2-[(7-chloroquinolin-4-yl)amino]phenyl]acetate;hydrochloride (PubChem CID 69165819) has the molecular formula C21H22Cl2N2O2 and a molecular weight of 405.33 g/mol. Its IUPAC name is butyl 2-[2-[(7-chloroquinolin-4-yl)amino]phenyl]acetate;hydrochloride.
| Compound Name | butyl 2-[2-[(7-chloroquinolin-4-yl)amino]phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 69165819 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | butyl 2-[2-[(7-chloroquinolin-4-yl)amino]phenyl]acetate;hydrochloride |
| SMILES | CCCCOC(=O)Cc1ccccc1Nc1ccnc2cc(Cl)ccc12.Cl |
| InChI | InChI=1S/C21H21ClN2O2.ClH/c1-2-3-12-26-21(25)13-15-6-4-5-7-18(15)24-19-10-11-23-20-14-16(22)8-9-17(19)20;/h4-11,14H,2-3,12-13H2,1H3,(H,23,24);1H |
| InChIKey | SXYWGGGNHCAUGA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|