C20H23Cl2NO3 — CID 159842705
2-butoxyethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 159842705) has the molecular formula C20H23Cl2NO3 and a molecular weight of 396.31 g/mol. Its IUPAC name is 2-butoxyethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | 2-butoxyethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 159842705 |
| Molecular Formula | C20H23Cl2NO3 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-butoxyethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | CCCCOCCOC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H23Cl2NO3/c1-2-3-11-25-12-13-26-19(24)14-15-7-4-5-10-18(15)23-20-16(21)8-6-9-17(20)22/h4-10,23H,2-3,11-14H2,1H3 |
| InChIKey | DNTKRDPYVPLAHN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|