C18H21Cl2N2O3+ — CID 59352016
2-[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyethoxy]ethylazanium (PubChem CID 59352016) has the molecular formula C18H21Cl2N2O3+ and a molecular weight of 384.28 g/mol. Its IUPAC name is 2-[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyethoxy]ethylazanium.
| Compound Name | 2-[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyethoxy]ethylazanium |
|---|---|
| PubChem CID | 59352016 |
| Molecular Formula | C18H21Cl2N2O3+ |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyethoxy]ethylazanium |
| SMILES | [NH3+]CCOCCOC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O3/c19-14-5-3-6-15(20)18(14)22-16-7-2-1-4-13(16)12-17(23)25-11-10-24-9-8-21/h1-7,22H,8-12,21H2/p+1 |
| InChIKey | GHLOWSCCYURFCU-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|