C27H25Cl2N3O3 — CID 71558419
2-[2-(2-phenylimidazol-1-yl)ethoxy]ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 71558419) has the molecular formula C27H25Cl2N3O3 and a molecular weight of 510.42 g/mol. Its IUPAC name is 2-[2-(2-phenylimidazol-1-yl)ethoxy]ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | 2-[2-(2-phenylimidazol-1-yl)ethoxy]ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 71558419 |
| Molecular Formula | C27H25Cl2N3O3 |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 2-[2-(2-phenylimidazol-1-yl)ethoxy]ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | O=C(Cc1ccccc1Nc1c(Cl)cccc1Cl)OCCOCCn1ccnc1-c1ccccc1 |
| InChI | InChI=1S/C27H25Cl2N3O3/c28-22-10-6-11-23(29)26(22)31-24-12-5-4-9-21(24)19-25(33)35-18-17-34-16-15-32-14-13-30-27(32)20-7-2-1-3-8-20/h1-14,31H,15-19H2 |
| InChIKey | QIWPYICKTZTKFW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|