C16H17Cl2NO4S — CID 54173996
2-(2-hydroxyethoxy)ethyl 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetate (PubChem CID 54173996) has the molecular formula C16H17Cl2NO4S and a molecular weight of 390.29 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetate |
|---|---|
| PubChem CID | 54173996 |
| Molecular Formula | C16H17Cl2NO4S |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetate |
| SMILES | O=C(Cc1cscc1Nc1c(Cl)cccc1Cl)OCCOCCO |
| InChI | InChI=1S/C16H17Cl2NO4S/c17-12-2-1-3-13(18)16(12)19-14-10-24-9-11(14)8-15(21)23-7-6-22-5-4-20/h1-3,9-10,19-20H,4-8H2 |
| InChIKey | OWZDDSVJSWNHMH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|