About 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate
3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate (PubChem CID 70573815) has the molecular formula C18H20ClNO4S
and a molecular weight of 381.88 g/mol. Its IUPAC name is 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate.
Molecular Properties
| Compound Name | 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate |
| PubChem CID | 70573815 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate |
| SMILES | CC(=O)OCCCOC(=O)Cc1cscc1Nc1cccc(C)c1Cl |
| InChI | InChI=1S/C18H20ClNO4S/c1-12-5-3-6-15(18(12)19)20-16-11-25-10-14(16)9-17(22)24-8-4-7-23-13(2)21/h3,5-6,10-11,20H,4,7-9H2,1-2H3 |
| InChIKey | XBSNEKSCRUEWIH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate?
The IUPAC name of 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate (CID 70573815) is 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate.
What is the SMILES notation for 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate?
The canonical SMILES for 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate is CC(=O)OCCCOC(=O)Cc1cscc1Nc1cccc(C)c1Cl.
What is the InChIKey of 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate?
The InChIKey is XBSNEKSCRUEWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClNO4S/c1-12-5-3-6-15(18(12)19)20-16-11-25-10-14(16)9-17(22)24-8-4-7-23-13(2)21/h3,5-6,10-11,20H,4,7-9H2,1-2H3.
What are the key properties of 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate?
3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate has a molecular weight of 381.88 g/mol, XLogP of 4.49, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyloxypropyl 2-[4-(2-chloro-3-methylanilino)thiophen-3-yl]acetate is sourced from PubChem (CID 70573815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).