C18H22ClNO4S — CID 70573562
2-(2-hydroxyethoxy)ethyl 2-[5-chloro-4-(2,3-dimethylanilino)thiophen-3-yl]acetate (PubChem CID 70573562) has the molecular formula C18H22ClNO4S and a molecular weight of 383.90 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-[5-chloro-4-(2,3-dimethylanilino)thiophen-3-yl]acetate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-[5-chloro-4-(2,3-dimethylanilino)thiophen-3-yl]acetate |
|---|---|
| PubChem CID | 70573562 |
| Molecular Formula | C18H22ClNO4S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-[5-chloro-4-(2,3-dimethylanilino)thiophen-3-yl]acetate |
| SMILES | Cc1cccc(Nc2c(CC(=O)OCCOCCO)csc2Cl)c1C |
| InChI | InChI=1S/C18H22ClNO4S/c1-12-4-3-5-15(13(12)2)20-17-14(11-25-18(17)19)10-16(22)24-9-8-23-7-6-21/h3-5,11,20-21H,6-10H2,1-2H3 |
| InChIKey | ZZCXDLSQCBMTLB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|