C32H28Cl4N2O5 — CID 59981465
2-[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyethoxy]ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 59981465) has the molecular formula C32H28Cl4N2O5 and a molecular weight of 662.40 g/mol. Its IUPAC name is 2-[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyethoxy]ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | 2-[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyethoxy]ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 59981465 |
| Molecular Formula | C32H28Cl4N2O5 |
| Molecular Weight | 662.40 g/mol |
| Exact Mass | 660.08 |
| IUPAC Name | 2-[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyethoxy]ethyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | O=C(Cc1ccccc1Nc1c(Cl)cccc1Cl)OCCOCCOC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C32H28Cl4N2O5/c33-23-9-5-10-24(34)31(23)37-27-13-3-1-7-21(27)19-29(39)42-17-15-41-16-18-43-30(40)20-22-8-2-4-14-28(22)38-32-25(35)11-6-12-26(32)36/h1-14,37-38H,15-20H2 |
| InChIKey | DVNMGPKWTSSELN-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.40 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|