C20H21Cl2NO6 — CID 142648888
[2-(2-methoxyethoxymethoxy)-2-oxoethyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 142648888) has the molecular formula C20H21Cl2NO6 and a molecular weight of 442.30 g/mol. Its IUPAC name is [2-(2-methoxyethoxymethoxy)-2-oxoethyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | [2-(2-methoxyethoxymethoxy)-2-oxoethyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 142648888 |
| Molecular Formula | C20H21Cl2NO6 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | [2-(2-methoxyethoxymethoxy)-2-oxoethyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | COCCOCOC(=O)COC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H21Cl2NO6/c1-26-9-10-27-13-29-19(25)12-28-18(24)11-14-5-2-3-8-17(14)23-20-15(21)6-4-7-16(20)22/h2-8,23H,9-13H2,1H3 |
| InChIKey | YRCQEIFJPIBHHX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|