C18H20Cl2N2O2 — CID 126576343
2-[2-(2,6-dichloroanilino)phenyl]-N-(2-ethoxyethyl)acetamide (PubChem CID 126576343) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is 2-[2-(2,6-dichloroanilino)phenyl]-N-(2-ethoxyethyl)acetamide.
| Compound Name | 2-[2-(2,6-dichloroanilino)phenyl]-N-(2-ethoxyethyl)acetamide |
|---|---|
| PubChem CID | 126576343 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-[2-(2,6-dichloroanilino)phenyl]-N-(2-ethoxyethyl)acetamide |
| SMILES | CCOCCNC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O2/c1-2-24-11-10-21-17(23)12-13-6-3-4-9-16(13)22-18-14(19)7-5-8-15(18)20/h3-9,22H,2,10-12H2,1H3,(H,21,23) |
| InChIKey | GTXSSOAMWGLBHU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|