C14H13Cl2NO2Sr — CID 173032882
strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride (PubChem CID 173032882) has the molecular formula C14H13Cl2NO2Sr and a molecular weight of 385.79 g/mol. Its IUPAC name is strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride.
| Compound Name | strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride |
|---|---|
| PubChem CID | 173032882 |
| Molecular Formula | C14H13Cl2NO2Sr |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride |
| SMILES | O=C(O)Cc1ccccc1Nc1c(Cl)cccc1Cl.[H-].[H-].[Sr+2] |
| InChI | InChI=1S/C14H11Cl2NO2.Sr.2H/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;;;/h1-7,17H,8H2,(H,18,19);;;/q;+2;2*-1 |
| InChIKey | YPRNSPIUNZGXCE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |