About Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride
Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride (PubChem CID 173032882) has the molecular formula C14H13Cl2NO2Sr
and a molecular weight of 385.80 g/mol. Its IUPAC name is strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride.
Molecular Properties
| Compound Name | Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride |
| PubChem CID | 173032882 |
| Molecular Formula | C14H13Cl2NO2Sr |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride |
| SMILES | [H-].[H-].C1=CC=C(C(=C1)CC(=O)O)NC2=C(C=CC=C2Cl)Cl.[Sr+2] |
| InChI | InChI=1S/C14H11Cl2NO2.Sr.2H/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;;;/h1-7,17H,8H2,(H,18,19);;;/q;+2;2*-1 |
| InChIKey | YPRNSPIUNZGXCE-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 304 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride?
The IUPAC name of Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride (CID 173032882) is strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride.
What is the SMILES notation for Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride?
The canonical SMILES for Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride is [H-].[H-].C1=CC=C(C(=C1)CC(=O)O)NC2=C(C=CC=C2Cl)Cl.[Sr+2].
What is the InChIKey of Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride?
The InChIKey is YPRNSPIUNZGXCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2NO2.Sr.2H/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;;;/h1-7,17H,8H2,(H,18,19);;;/q;+2;2*-1.
What are the key properties of Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride?
Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride has a molecular weight of 385.80 g/mol, XLogP of not available, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Strontium;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydride is sourced from PubChem (CID 173032882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).