C16H19Cl3N2O3 — CID 86623054
1-aminoethanol;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydrochloride (PubChem CID 86623054) has the molecular formula C16H19Cl3N2O3 and a molecular weight of 393.70 g/mol. Its IUPAC name is 1-aminoethanol;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydrochloride.
| Compound Name | 1-aminoethanol;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 86623054 |
| Molecular Formula | C16H19Cl3N2O3 |
| Molecular Weight | 393.70 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 1-aminoethanol;2-[2-(2,6-dichloroanilino)phenyl]acetic acid;hydrochloride |
| SMILES | CC(N)O.Cl.O=C(O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H11Cl2NO2.C2H7NO.ClH/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;1-2(3)4;/h1-7,17H,8H2,(H,18,19);2,4H,3H2,1H3;1H |
| InChIKey | NYVQOWQNWFQQRC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.70 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|