C35H38Cl2N2O3 — CID 11628651
2-[2-(2,6-dichloroanilino)phenyl]acetic acid;6-(dimethylamino)-4,4-diphenylheptan-3-one (PubChem CID 11628651) has the molecular formula C35H38Cl2N2O3 and a molecular weight of 605.61 g/mol. Its IUPAC name is 2-[2-(2,6-dichloroanilino)phenyl]acetic acid;6-(dimethylamino)-4,4-diphenylheptan-3-one.
| Compound Name | 2-[2-(2,6-dichloroanilino)phenyl]acetic acid;6-(dimethylamino)-4,4-diphenylheptan-3-one |
|---|---|
| PubChem CID | 11628651 |
| Molecular Formula | C35H38Cl2N2O3 |
| Molecular Weight | 605.61 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | 2-[2-(2,6-dichloroanilino)phenyl]acetic acid;6-(dimethylamino)-4,4-diphenylheptan-3-one |
| SMILES | CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1.O=C(O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H27NO.C14H11Cl2NO2/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19;15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h6-15,17H,5,16H2,1-4H3;1-7,17H,8H2,(H,18,19) |
| InChIKey | CHEPCNLUWFDWAI-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.61 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |