C28H21AsCl4NO4 — CID 87829814
CID 87829814 (PubChem CID 87829814) has the molecular formula C28H21AsCl4NO4 and a molecular weight of 652.21 g/mol.
| Compound Name | CID 87829814 |
|---|---|
| PubChem CID | 87829814 |
| Molecular Formula | C28H21AsCl4NO4 |
| Molecular Weight | 652.21 g/mol |
| Exact Mass | 649.94 |
| IUPAC Name | — |
| SMILES | O=C(O)Cc1ccccc1Nc1c(Cl)cccc1Cl.O=C(O)Cc1ccccc1[As]c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H10AsCl2O2.C14H11Cl2NO2/c16-11-6-3-7-12(17)14(11)15-10-5-2-1-4-9(10)8-13(18)19;15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7H,8H2,(H,18,19);1-7,17H,8H2,(H,18,19) |
| InChIKey | CERSRNGMMLHLTP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.21 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|