C17H17Cl2NO4 — CID 90057801
1,3-dihydroxypropan-2-yl 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 90057801) has the molecular formula C17H17Cl2NO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | 1,3-dihydroxypropan-2-yl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 90057801 |
| Molecular Formula | C17H17Cl2NO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | O=C(Cc1ccccc1Nc1c(Cl)cccc1Cl)OC(CO)CO |
| InChI | InChI=1S/C17H17Cl2NO4/c18-13-5-3-6-14(19)17(13)20-15-7-2-1-4-11(15)8-16(23)24-12(9-21)10-22/h1-7,12,20-22H,8-10H2 |
| InChIKey | AAIXLQJJGCWBKY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |