C14H11Cl2NO2 — CID 10661763
2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid (PubChem CID 10661763) has the molecular formula C14H11Cl2NO2 and a molecular weight of 298.17 g/mol. Its IUPAC name is 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid.
| Compound Name | 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid |
|---|---|
| PubChem CID | 10661763 |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid |
| SMILES | [2H]C([2H])(C(=O)O)c1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19)/i8D2 |
| InChIKey | DCOPUUMXTXDBNB-MGVXTIMCSA-N |
| XLogP | 4.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |