2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid

C14H11Cl2NO2 — CID 10661763

IUPAC2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid
SMILES[2H]C([2H])(C(=O)O)c1ccccc1Nc1c(Cl)cccc1Cl
InChIInChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19)/i8D2
InChIKeyDCOPUUMXTXDBNB-MGVXTIMCSA-N
MW298.17 g/mol
LogP4.36
Rot. Bonds4

About 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid

2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid (PubChem CID 10661763) has the molecular formula C14H11Cl2NO2 and a molecular weight of 298.17 g/mol. Its IUPAC name is 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid.

Molecular Properties

Compound Name2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid
PubChem CID10661763
Molecular FormulaC14H11Cl2NO2
Molecular Weight298.17 g/mol
Exact Mass297.03
IUPAC Name2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid
SMILES[2H]C([2H])(C(=O)O)c1ccccc1Nc1c(Cl)cccc1Cl
InChIInChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19)/i8D2
InChIKeyDCOPUUMXTXDBNB-MGVXTIMCSA-N
XLogP4.36
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.17
LogP ≤ 54.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid?
The IUPAC name of 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid (CID 10661763) is 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid.
What is the SMILES notation for 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid?
The canonical SMILES for 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid is [2H]C([2H])(C(=O)O)c1ccccc1Nc1c(Cl)cccc1Cl.
What is the InChIKey of 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid?
The InChIKey is DCOPUUMXTXDBNB-MGVXTIMCSA-N. The full InChI is InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19)/i8D2.
What are the key properties of 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid?
2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid has a molecular weight of 298.17 g/mol, XLogP of 4.36, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dideuterio-2-[2-(2,6-dichloroanilino)phenyl]acetic acid is sourced from PubChem (CID 10661763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).