C20H15Cl3N2O — CID 23764468
N-(4-chlorophenyl)-2-[2-(2,6-dichloroanilino)phenyl]acetamide (PubChem CID 23764468) has the molecular formula C20H15Cl3N2O and a molecular weight of 405.71 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-(2,6-dichloroanilino)phenyl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-(2,6-dichloroanilino)phenyl]acetamide |
|---|---|
| PubChem CID | 23764468 |
| Molecular Formula | C20H15Cl3N2O |
| Molecular Weight | 405.71 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-(2,6-dichloroanilino)phenyl]acetamide |
| SMILES | O=C(Cc1ccccc1Nc1c(Cl)cccc1Cl)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15Cl3N2O/c21-14-8-10-15(11-9-14)24-19(26)12-13-4-1-2-7-18(13)25-20-16(22)5-3-6-17(20)23/h1-11,25H,12H2,(H,24,26) |
| InChIKey | PUOJAQBHEPXPSG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.71 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |