C20H25Cl2N5O4 — CID 12853028
2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-(2,6-dichloroanilino)phenyl]acetic acid (PubChem CID 12853028) has the molecular formula C20H25Cl2N5O4 and a molecular weight of 470.36 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-(2,6-dichloroanilino)phenyl]acetic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-(2,6-dichloroanilino)phenyl]acetic acid |
|---|---|
| PubChem CID | 12853028 |
| Molecular Formula | C20H25Cl2N5O4 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-(2,6-dichloroanilino)phenyl]acetic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)O.O=C(O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H11Cl2NO2.C6H14N4O2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;7-4(5(11)12)2-1-3-10-6(8)9/h1-7,17H,8H2,(H,18,19);4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| InChIKey | CIULGMNAOZQOLO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|