C22H27Cl2N5O6 — CID 52912197
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid (PubChem CID 52912197) has the molecular formula C22H27Cl2N5O6 and a molecular weight of 528.39 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid |
|---|---|
| PubChem CID | 52912197 |
| Molecular Formula | C22H27Cl2N5O6 |
| Molecular Weight | 528.39 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)O.O=C(O)COC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl2NO4.C6H14N4O2/c17-11-5-3-6-12(18)16(11)19-13-7-2-1-4-10(13)8-15(22)23-9-14(20)21;7-4(5(11)12)2-1-3-10-6(8)9/h1-7,19H,8-9H2,(H,20,21);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1 |
| InChIKey | VTRMOHURYZAUFP-VWMHFEHESA-N |
| XLogP | 2.36 |
| TPSA | 203.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|