C23H30Cl2N2O10 — CID 25097346
2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid;6-(methylamino)hexane-1,1,2,3,4,5-hexol (PubChem CID 25097346) has the molecular formula C23H30Cl2N2O10 and a molecular weight of 565.40 g/mol. Its IUPAC name is 2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid;6-(methylamino)hexane-1,1,2,3,4,5-hexol.
| Compound Name | 2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid;6-(methylamino)hexane-1,1,2,3,4,5-hexol |
|---|---|
| PubChem CID | 25097346 |
| Molecular Formula | C23H30Cl2N2O10 |
| Molecular Weight | 565.40 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | 2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid;6-(methylamino)hexane-1,1,2,3,4,5-hexol |
| SMILES | CNCC(O)C(O)C(O)C(O)C(O)O.O=C(O)COC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl2NO4.C7H17NO6/c17-11-5-3-6-12(18)16(11)19-13-7-2-1-4-10(13)8-15(22)23-9-14(20)21;1-8-2-3(9)4(10)5(11)6(12)7(13)14/h1-7,19H,8-9H2,(H,20,21);3-14H,2H2,1H3 |
| InChIKey | IKZKPYDUYSMEBP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 209.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.40 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|