C16H13Cl2NO8S — CID 154700133
2-[2-[2-(2,6-dichloro-4-sulfooxyanilino)phenyl]acetyl]oxyacetic acid (PubChem CID 154700133) has the molecular formula C16H13Cl2NO8S and a molecular weight of 450.25 g/mol. Its IUPAC name is 2-[2-[2-(2,6-dichloro-4-sulfooxyanilino)phenyl]acetyl]oxyacetic acid.
| Compound Name | 2-[2-[2-(2,6-dichloro-4-sulfooxyanilino)phenyl]acetyl]oxyacetic acid |
|---|---|
| PubChem CID | 154700133 |
| Molecular Formula | C16H13Cl2NO8S |
| Molecular Weight | 450.25 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | 2-[2-[2-(2,6-dichloro-4-sulfooxyanilino)phenyl]acetyl]oxyacetic acid |
| SMILES | O=C(O)COC(=O)Cc1ccccc1Nc1c(Cl)cc(OS(=O)(=O)O)cc1Cl |
| InChI | InChI=1S/C16H13Cl2NO8S/c17-11-6-10(27-28(23,24)25)7-12(18)16(11)19-13-4-2-1-3-9(13)5-15(22)26-8-14(20)21/h1-4,6-7,19H,5,8H2,(H,20,21)(H,23,24,25) |
| InChIKey | ZAQMXKOBGNZADV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|