C29H30Cl2N2O6 — CID 174660481
2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid;2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid (PubChem CID 174660481) has the molecular formula C29H30Cl2N2O6 and a molecular weight of 573.47 g/mol. Its IUPAC name is 2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid;2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid.
| Compound Name | 2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid;2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 174660481 |
| Molecular Formula | C29H30Cl2N2O6 |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | 2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetic acid;2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid |
| SMILES | C=C(C)CNc1ccc(C(C)C(=O)O)cc1.O=C(O)COC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl2NO4.C13H17NO2/c17-11-5-3-6-12(18)16(11)19-13-7-2-1-4-10(13)8-15(22)23-9-14(20)21;1-9(2)8-14-12-6-4-11(5-7-12)10(3)13(15)16/h1-7,19H,8-9H2,(H,20,21);4-7,10,14H,1,8H2,2-3H3,(H,15,16) |
| InChIKey | OOBPTMHZDJTURY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|