C31H33NO10 — CID 70296496
bis(2-acetyloxybenzoic acid);2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid (PubChem CID 70296496) has the molecular formula C31H33NO10 and a molecular weight of 579.60 g/mol. Its IUPAC name is bis(2-acetyloxybenzoic acid);2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid.
| Compound Name | bis(2-acetyloxybenzoic acid);2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 70296496 |
| Molecular Formula | C31H33NO10 |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | bis(2-acetyloxybenzoic acid);2-[4-(2-methylprop-2-enylamino)phenyl]propanoic acid |
| SMILES | C=C(C)CNc1ccc(C(C)C(=O)O)cc1.CC(=O)Oc1ccccc1C(=O)O.CC(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C13H17NO2.2C9H8O4/c1-9(2)8-14-12-6-4-11(5-7-12)10(3)13(15)16;2*1-6(10)13-8-5-3-2-4-7(8)9(11)12/h4-7,10,14H,1,8H2,2-3H3,(H,15,16);2*2-5H,1H3,(H,11,12) |
| InChIKey | UZBAUCAUUFVLQQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|