C20H22Cl2N2O2 — CID 22824884
2-[2-(2,6-dichloroanilino)phenyl]-N-[(2S)-4-methyl-1-oxopentan-2-yl]acetamide (PubChem CID 22824884) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is 2-[2-(2,6-dichloroanilino)phenyl]-N-[(2S)-4-methyl-1-oxopentan-2-yl]acetamide.
| Compound Name | 2-[2-(2,6-dichloroanilino)phenyl]-N-[(2S)-4-methyl-1-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 22824884 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[2-(2,6-dichloroanilino)phenyl]-N-[(2S)-4-methyl-1-oxopentan-2-yl]acetamide |
| SMILES | CC(C)C[C@@H](C=O)NC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-13(2)10-15(12-25)23-19(26)11-14-6-3-4-9-18(14)24-20-16(21)7-5-8-17(20)22/h3-9,12-13,15,24H,10-11H2,1-2H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | RZZNXLGCBWKDIY-HNNXBMFYSA-N |
| XLogP | 5.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|