C18H22Cl2N2O5 — CID 15917937
2-[2-(2,6-dichloroanilino)phenyl]acetate;tris(hydroxymethyl)-methylazanium (PubChem CID 15917937) has the molecular formula C18H22Cl2N2O5 and a molecular weight of 417.29 g/mol. Its IUPAC name is 2-[2-(2,6-dichloroanilino)phenyl]acetate;tris(hydroxymethyl)-methylazanium.
| Compound Name | 2-[2-(2,6-dichloroanilino)phenyl]acetate;tris(hydroxymethyl)-methylazanium |
|---|---|
| PubChem CID | 15917937 |
| Molecular Formula | C18H22Cl2N2O5 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[2-(2,6-dichloroanilino)phenyl]acetate;tris(hydroxymethyl)-methylazanium |
| SMILES | C[N+](CO)(CO)CO.O=C([O-])Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H11Cl2NO2.C4H12NO3/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;1-5(2-6,3-7)4-8/h1-7,17H,8H2,(H,18,19);6-8H,2-4H2,1H3/q;+1/p-1 |
| InChIKey | NJTLAOVYRDBVEY-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|