C15H12Cl2NNaO2 — CID 23689082
sodium 2-[2-(2,6-dichloroanilino)-5-methylphenyl]acetate (PubChem CID 23689082) has the molecular formula C15H12Cl2NNaO2 and a molecular weight of 332.16 g/mol. Its IUPAC name is sodium 2-[2-(2,6-dichloroanilino)-5-methylphenyl]acetate.
| Compound Name | sodium 2-[2-(2,6-dichloroanilino)-5-methylphenyl]acetate |
|---|---|
| PubChem CID | 23689082 |
| Molecular Formula | C15H12Cl2NNaO2 |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | sodium 2-[2-(2,6-dichloroanilino)-5-methylphenyl]acetate |
| SMILES | Cc1ccc(Nc2c(Cl)cccc2Cl)c(CC(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C15H13Cl2NO2.Na/c1-9-5-6-13(10(7-9)8-14(19)20)18-15-11(16)3-2-4-12(15)17;/h2-7,18H,8H2,1H3,(H,19,20);/q;+1/p-1 |
| InChIKey | UWCKEAXOYPUQCE-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |