C12H8Cl2NNaO2S — CID 23686411
sodium 2-[3-(2,6-dichloroanilino)thiophen-2-yl]acetate (PubChem CID 23686411) has the molecular formula C12H8Cl2NNaO2S and a molecular weight of 324.16 g/mol. Its IUPAC name is sodium 2-[3-(2,6-dichloroanilino)thiophen-2-yl]acetate.
| Compound Name | sodium 2-[3-(2,6-dichloroanilino)thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 23686411 |
| Molecular Formula | C12H8Cl2NNaO2S |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | sodium 2-[3-(2,6-dichloroanilino)thiophen-2-yl]acetate |
| SMILES | O=C([O-])Cc1sccc1Nc1c(Cl)cccc1Cl.[Na+] |
| InChI | InChI=1S/C12H9Cl2NO2S.Na/c13-7-2-1-3-8(14)12(7)15-9-4-5-18-10(9)6-11(16)17;/h1-5,15H,6H2,(H,16,17);/q;+1/p-1 |
| InChIKey | FSIYCAMYHDOOHJ-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |