C16H14Cl2NNaO2 — CID 23672276
sodium 2-[2-(2,6-dichloroanilino)phenyl]butanoate (PubChem CID 23672276) has the molecular formula C16H14Cl2NNaO2 and a molecular weight of 346.19 g/mol. Its IUPAC name is sodium 2-[2-(2,6-dichloroanilino)phenyl]butanoate.
| Compound Name | sodium 2-[2-(2,6-dichloroanilino)phenyl]butanoate |
|---|---|
| PubChem CID | 23672276 |
| Molecular Formula | C16H14Cl2NNaO2 |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | sodium 2-[2-(2,6-dichloroanilino)phenyl]butanoate |
| SMILES | CCC(C(=O)[O-])c1ccccc1Nc1c(Cl)cccc1Cl.[Na+] |
| InChI | InChI=1S/C16H15Cl2NO2.Na/c1-2-10(16(20)21)11-6-3-4-9-14(11)19-15-12(17)7-5-8-13(15)18;/h3-10,19H,2H2,1H3,(H,20,21);/q;+1/p-1 |
| InChIKey | NBDMKDDSIXYNGV-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |