C20H25Cl2N3O — CID 174469725
(2R)-2-[2-(2,6-dichloroanilino)phenyl]-N-[1-(dimethylamino)propyl]propanamide (PubChem CID 174469725) has the molecular formula C20H25Cl2N3O and a molecular weight of 394.35 g/mol. Its IUPAC name is (2R)-2-[2-(2,6-dichloroanilino)phenyl]-N-[1-(dimethylamino)propyl]propanamide.
| Compound Name | (2R)-2-[2-(2,6-dichloroanilino)phenyl]-N-[1-(dimethylamino)propyl]propanamide |
|---|---|
| PubChem CID | 174469725 |
| Molecular Formula | C20H25Cl2N3O |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (2R)-2-[2-(2,6-dichloroanilino)phenyl]-N-[1-(dimethylamino)propyl]propanamide |
| SMILES | CCC(NC(=O)[C@H](C)c1ccccc1Nc1c(Cl)cccc1Cl)N(C)C |
| InChI | InChI=1S/C20H25Cl2N3O/c1-5-18(25(3)4)24-20(26)13(2)14-9-6-7-12-17(14)23-19-15(21)10-8-11-16(19)22/h6-13,18,23H,5H2,1-4H3,(H,24,26)/t13-,18?/m1/s1 |
| InChIKey | ZTLZTSKBIICPBP-YJJYDOSJSA-N |
| XLogP | 5.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|