C22H32Cl2N3O4S+ — CID 87937162
3-[2-[2-(2,6-dichloroanilino)phenyl]propanoylamino]propyl-trimethylazanium;methanesulfonic acid (PubChem CID 87937162) has the molecular formula C22H32Cl2N3O4S+ and a molecular weight of 505.49 g/mol. Its IUPAC name is 3-[2-[2-(2,6-dichloroanilino)phenyl]propanoylamino]propyl-trimethylazanium;methanesulfonic acid.
| Compound Name | 3-[2-[2-(2,6-dichloroanilino)phenyl]propanoylamino]propyl-trimethylazanium;methanesulfonic acid |
|---|---|
| PubChem CID | 87937162 |
| Molecular Formula | C22H32Cl2N3O4S+ |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 3-[2-[2-(2,6-dichloroanilino)phenyl]propanoylamino]propyl-trimethylazanium;methanesulfonic acid |
| SMILES | CC(C(=O)NCCC[N+](C)(C)C)c1ccccc1Nc1c(Cl)cccc1Cl.CS(=O)(=O)O |
| InChI | InChI=1S/C21H27Cl2N3O.CH4O3S/c1-15(21(27)24-13-8-14-26(2,3)4)16-9-5-6-12-19(16)25-20-17(22)10-7-11-18(20)23;1-5(2,3)4/h5-7,9-12,15,25H,8,13-14H2,1-4H3;1H3,(H,2,3,4)/p+1 |
| InChIKey | DCHZLHDQGXJAAP-UHFFFAOYSA-O |
| XLogP | 4.56 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|