C19H33N2O+ — CID 10274425
trimethyl-[3-[[(2R)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]propyl]azanium (PubChem CID 10274425) has the molecular formula C19H33N2O+ and a molecular weight of 305.49 g/mol. Its IUPAC name is trimethyl-[3-[[(2R)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]propyl]azanium.
| Compound Name | trimethyl-[3-[[(2R)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 10274425 |
| Molecular Formula | C19H33N2O+ |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.26 |
| IUPAC Name | trimethyl-[3-[[(2R)-2-[4-(2-methylpropyl)phenyl]propanoyl]amino]propyl]azanium |
| SMILES | CC(C)Cc1ccc([C@@H](C)C(=O)NCCC[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C19H32N2O/c1-15(2)14-17-8-10-18(11-9-17)16(3)19(22)20-12-7-13-21(4,5)6/h8-11,15-16H,7,12-14H2,1-6H3/p+1/t16-/m1/s1 |
| InChIKey | CTNJKUQEEPJEIS-MRXNPFEDSA-O |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|