C22H39N2O+ — CID 22218584
triethyl-[3-[2-[4-(2-methylpropyl)phenyl]propanoylamino]propyl]azanium (PubChem CID 22218584) has the molecular formula C22H39N2O+ and a molecular weight of 347.57 g/mol. Its IUPAC name is triethyl-[3-[2-[4-(2-methylpropyl)phenyl]propanoylamino]propyl]azanium.
| Compound Name | triethyl-[3-[2-[4-(2-methylpropyl)phenyl]propanoylamino]propyl]azanium |
|---|---|
| PubChem CID | 22218584 |
| Molecular Formula | C22H39N2O+ |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.31 |
| IUPAC Name | triethyl-[3-[2-[4-(2-methylpropyl)phenyl]propanoylamino]propyl]azanium |
| SMILES | CC[N+](CC)(CC)CCCNC(=O)C(C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C22H38N2O/c1-7-24(8-2,9-3)16-10-15-23-22(25)19(6)21-13-11-20(12-14-21)17-18(4)5/h11-14,18-19H,7-10,15-17H2,1-6H3/p+1 |
| InChIKey | WCNWWKFXFSLAID-UHFFFAOYSA-O |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|