C15H25NO — CID 166540473
(2R)-N-ethyl-2-[4-(2-methylpropyl)phenyl]propanamide;molecular hydrogen (PubChem CID 166540473) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2R)-N-ethyl-2-[4-(2-methylpropyl)phenyl]propanamide;molecular hydrogen.
| Compound Name | (2R)-N-ethyl-2-[4-(2-methylpropyl)phenyl]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 166540473 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2R)-N-ethyl-2-[4-(2-methylpropyl)phenyl]propanamide;molecular hydrogen |
| SMILES | CCNC(=O)[C@H](C)c1ccc(CC(C)C)cc1.[H][H] |
| InChI | InChI=1S/C15H23NO.H2/c1-5-16-15(17)12(4)14-8-6-13(7-9-14)10-11(2)3;/h6-9,11-12H,5,10H2,1-4H3,(H,16,17);1H/t12-;/m1./s1 |
| InChIKey | FIYFVKUKWCGBFE-UTONKHPSSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |