C17H28N4O — CID 121452328
(2R)-N-[3-(diaminomethylideneamino)propyl]-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 121452328) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is (2R)-N-[3-(diaminomethylideneamino)propyl]-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | (2R)-N-[3-(diaminomethylideneamino)propyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 121452328 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | (2R)-N-[3-(diaminomethylideneamino)propyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | CC(C)Cc1ccc([C@@H](C)C(=O)NCCCN=C(N)N)cc1 |
| InChI | InChI=1S/C17H28N4O/c1-12(2)11-14-5-7-15(8-6-14)13(3)16(22)20-9-4-10-21-17(18)19/h5-8,12-13H,4,9-11H2,1-3H3,(H,20,22)(H4,18,19,21)/t13-/m1/s1 |
| InChIKey | KRIHBLNKEWLZAQ-CYBMUJFWSA-N |
| XLogP | 1.77 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|